C14H15Cl2N5 — CID 112941981
N-(2,6-dichlorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 112941981) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | N-(2,6-dichlorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112941981 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-(2,6-dichlorophenyl)-5-piperidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | Clc1cccc(Cl)c1Nc1nncc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H15Cl2N5/c15-10-5-4-6-11(16)13(10)19-14-18-12(9-17-20-14)21-7-2-1-3-8-21/h4-6,9H,1-3,7-8H2,(H,18,19,20) |
| InChIKey | FPPPNXFJMGXSFL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |