About 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile
5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile (PubChem CID 173047408) has the molecular formula C21H20N4O3
and a molecular weight of 376.42 g/mol. Its IUPAC name is 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile.
Molecular Properties
| Compound Name | 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile |
| PubChem CID | 173047408 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(-c2ccnc(Nc3cc(C)c(OC)c(OC)c3)n2)cc1C#N |
| InChI | InChI=1S/C21H20N4O3/c1-13-9-16(11-19(27-3)20(13)28-4)24-21-23-8-7-17(25-21)14-5-6-18(26-2)15(10-14)12-22/h5-11H,1-4H3,(H,23,24,25) |
| InChIKey | XSXUUZQAKRNXPG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile?
The IUPAC name of 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile (CID 173047408) is 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile.
What is the SMILES notation for 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile?
The canonical SMILES for 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile is COc1ccc(-c2ccnc(Nc3cc(C)c(OC)c(OC)c3)n2)cc1C#N.
What is the InChIKey of 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile?
The InChIKey is XSXUUZQAKRNXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3/c1-13-9-16(11-19(27-3)20(13)28-4)24-21-23-8-7-17(25-21)14-5-6-18(26-2)15(10-14)12-22/h5-11H,1-4H3,(H,23,24,25).
What are the key properties of 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile?
5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile has a molecular weight of 376.42 g/mol, XLogP of 4.09, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,4-dimethoxy-5-methylanilino)pyrimidin-4-yl]-2-methoxybenzonitrile is sourced from PubChem (CID 173047408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).