C22H22N4OS — CID 123728671
2-(2-methylpropoxy)-5-[2-[3-(sulfanylmethyl)anilino]pyrimidin-4-yl]benzonitrile (PubChem CID 123728671) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-(2-methylpropoxy)-5-[2-[3-(sulfanylmethyl)anilino]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-(2-methylpropoxy)-5-[2-[3-(sulfanylmethyl)anilino]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 123728671 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-(2-methylpropoxy)-5-[2-[3-(sulfanylmethyl)anilino]pyrimidin-4-yl]benzonitrile |
| SMILES | CC(C)COc1ccc(-c2ccnc(Nc3cccc(CS)c3)n2)cc1C#N |
| InChI | InChI=1S/C22H22N4OS/c1-15(2)13-27-21-7-6-17(11-18(21)12-23)20-8-9-24-22(26-20)25-19-5-3-4-16(10-19)14-28/h3-11,15,28H,13-14H2,1-2H3,(H,24,25,26) |
| InChIKey | QYNGBWVZBQMROM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|