C19H19ClN4O — CID 16746118
4-(2-butan-2-yloxy-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine (PubChem CID 16746118) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is 4-(2-butan-2-yloxy-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(2-butan-2-yloxy-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 16746118 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-(2-butan-2-yloxy-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
| SMILES | CCC(C)Oc1cc(-c2ccnc(Nc3cccc(Cl)c3)n2)ccn1 |
| InChI | InChI=1S/C19H19ClN4O/c1-3-13(2)25-18-11-14(7-9-21-18)17-8-10-22-19(24-17)23-16-6-4-5-15(20)12-16/h4-13H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | ASJKXLWMEDOKEV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |