C17H15ClN4 — CID 67364353
N-(3-chlorophenyl)-4-(2-ethyl-4-pyridinyl)pyrimidin-2-amine (PubChem CID 67364353) has the molecular formula C17H15ClN4 and a molecular weight of 310.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(2-ethyl-4-pyridinyl)pyrimidin-2-amine.
| Compound Name | N-(3-chlorophenyl)-4-(2-ethyl-4-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 67364353 |
| Molecular Formula | C17H15ClN4 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(3-chlorophenyl)-4-(2-ethyl-4-pyridinyl)pyrimidin-2-amine |
| SMILES | CCc1cc(-c2ccnc(Nc3cccc(Cl)c3)n2)ccn1 |
| InChI | InChI=1S/C17H15ClN4/c1-2-14-10-12(6-8-19-14)16-7-9-20-17(22-16)21-15-5-3-4-13(18)11-15/h3-11H,2H2,1H3,(H,20,21,22) |
| InChIKey | XCNNDRBLBXRKLB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |