C16H12Cl2N4 — CID 24990163
4-(2-chloro-3-methyl-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine (PubChem CID 24990163) has the molecular formula C16H12Cl2N4 and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-(2-chloro-3-methyl-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine.
| Compound Name | 4-(2-chloro-3-methyl-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 24990163 |
| Molecular Formula | C16H12Cl2N4 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-(2-chloro-3-methyl-4-pyridinyl)-N-(3-chlorophenyl)pyrimidin-2-amine |
| SMILES | Cc1c(-c2ccnc(Nc3cccc(Cl)c3)n2)ccnc1Cl |
| InChI | InChI=1S/C16H12Cl2N4/c1-10-13(5-7-19-15(10)18)14-6-8-20-16(22-14)21-12-4-2-3-11(17)9-12/h2-9H,1H3,(H,20,21,22) |
| InChIKey | DPTGKKYSYSPYKV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|