C13H9ClN4S — CID 91806914
N-(3-chlorophenyl)-4-(1,3-thiazol-5-yl)pyrimidin-2-amine (PubChem CID 91806914) has the molecular formula C13H9ClN4S and a molecular weight of 288.76 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1,3-thiazol-5-yl)pyrimidin-2-amine.
| Compound Name | N-(3-chlorophenyl)-4-(1,3-thiazol-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 91806914 |
| Molecular Formula | C13H9ClN4S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1,3-thiazol-5-yl)pyrimidin-2-amine |
| SMILES | Clc1cccc(Nc2nccc(-c3cncs3)n2)c1 |
| InChI | InChI=1S/C13H9ClN4S/c14-9-2-1-3-10(6-9)17-13-16-5-4-11(18-13)12-7-15-8-19-12/h1-8H,(H,16,17,18) |
| InChIKey | CKKHRSBEQHMGLR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |