C18H17ClN6 — CID 142249187
N-(3-chlorophenyl)-4-[2-(2-propan-2-ylidenehydrazinyl)-4-pyridinyl]pyrimidin-2-amine (PubChem CID 142249187) has the molecular formula C18H17ClN6 and a molecular weight of 352.83 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-(2-propan-2-ylidenehydrazinyl)-4-pyridinyl]pyrimidin-2-amine.
| Compound Name | N-(3-chlorophenyl)-4-[2-(2-propan-2-ylidenehydrazinyl)-4-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 142249187 |
| Molecular Formula | C18H17ClN6 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-(2-propan-2-ylidenehydrazinyl)-4-pyridinyl]pyrimidin-2-amine |
| SMILES | CC(C)=NNc1cc(-c2ccnc(Nc3cccc(Cl)c3)n2)ccn1 |
| InChI | InChI=1S/C18H17ClN6/c1-12(2)24-25-17-10-13(6-8-20-17)16-7-9-21-18(23-16)22-15-5-3-4-14(19)11-15/h3-11H,1-2H3,(H,20,25)(H,21,22,23) |
| InChIKey | PWEDVCJFYMTVKH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|