About sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide
sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide (PubChem CID 23720657) has the molecular formula C16H14ClN4NaO
and a molecular weight of 336.76 g/mol. Its IUPAC name is sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide.
Molecular Properties
| Compound Name | sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide |
| PubChem CID | 23720657 |
| Molecular Formula | C16H14ClN4NaO |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide |
| SMILES | Cc1cccc(Nc2nccc(-c3ccnc(Cl)c3)n2)c1.[Na+].[OH-] |
| InChI | InChI=1S/C16H13ClN4.Na.H2O/c1-11-3-2-4-13(9-11)20-16-19-8-6-14(21-16)12-5-7-18-15(17)10-12;;/h2-10H,1H3,(H,19,20,21);;1H2/q;+1;/p-1 |
| InChIKey | GDKLHERQDUYCEK-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide?
The IUPAC name of sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide (CID 23720657) is sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide.
What is the SMILES notation for sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide?
The canonical SMILES for sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide is Cc1cccc(Nc2nccc(-c3ccnc(Cl)c3)n2)c1.[Na+].[OH-].
What is the InChIKey of sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide?
The InChIKey is GDKLHERQDUYCEK-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H13ClN4.Na.H2O/c1-11-3-2-4-13(9-11)20-16-19-8-6-14(21-16)12-5-7-18-15(17)10-12;;/h2-10H,1H3,(H,19,20,21);;1H2/q;+1;/p-1.
What are the key properties of sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide?
sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide has a molecular weight of 336.76 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(2-chloro-4-pyridinyl)-N-(3-methylphenyl)pyrimidin-2-amine;hydroxide is sourced from PubChem (CID 23720657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).