C16H15N5 — CID 11492825
3-N-[4-(3-aminophenyl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 11492825) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-N-[4-(3-aminophenyl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[4-(3-aminophenyl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 11492825 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-N-[4-(3-aminophenyl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nccc(-c3cccc(N)c3)n2)c1 |
| InChI | InChI=1S/C16H15N5/c17-12-4-1-3-11(9-12)15-7-8-19-16(21-15)20-14-6-2-5-13(18)10-14/h1-10H,17-18H2,(H,19,20,21) |
| InChIKey | XQMMCGXIGDHHFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|