C23H26N6O — CID 162655674
(3R)-6-[[4-(3-aminophenyl)pyrimidin-2-yl]amino]-1,3-dimethyl-4-propan-2-yl-3H-quinoxalin-2-one (PubChem CID 162655674) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is (3R)-6-[[4-(3-aminophenyl)pyrimidin-2-yl]amino]-1,3-dimethyl-4-propan-2-yl-3H-quinoxalin-2-one.
| Compound Name | (3R)-6-[[4-(3-aminophenyl)pyrimidin-2-yl]amino]-1,3-dimethyl-4-propan-2-yl-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 162655674 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (3R)-6-[[4-(3-aminophenyl)pyrimidin-2-yl]amino]-1,3-dimethyl-4-propan-2-yl-3H-quinoxalin-2-one |
| SMILES | CC(C)N1c2cc(Nc3nccc(-c4cccc(N)c4)n3)ccc2N(C)C(=O)[C@H]1C |
| InChI | InChI=1S/C23H26N6O/c1-14(2)29-15(3)22(30)28(4)20-9-8-18(13-21(20)29)26-23-25-11-10-19(27-23)16-6-5-7-17(24)12-16/h5-15H,24H2,1-4H3,(H,25,26,27)/t15-/m1/s1 |
| InChIKey | IVGGZYPSQXBUGB-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|