C15H13N5 — CID 11715896
4-N-(4-pyridin-4-ylpyrimidin-2-yl)benzene-1,4-diamine (PubChem CID 11715896) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-N-(4-pyridin-4-ylpyrimidin-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-pyridin-4-ylpyrimidin-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 11715896 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-N-(4-pyridin-4-ylpyrimidin-2-yl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2nccc(-c3ccncc3)n2)cc1 |
| InChI | InChI=1S/C15H13N5/c16-12-1-3-13(4-2-12)19-15-18-10-7-14(20-15)11-5-8-17-9-6-11/h1-10H,16H2,(H,18,19,20) |
| InChIKey | WCFVDHIMOUTJKQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|