C17H12F3N3 — CID 57446828
N-phenyl-4-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 57446828) has the molecular formula C17H12F3N3 and a molecular weight of 315.30 g/mol. Its IUPAC name is N-phenyl-4-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | N-phenyl-4-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 57446828 |
| Molecular Formula | C17H12F3N3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-phenyl-4-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccc(-c2ccnc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H12F3N3/c18-17(19,20)13-8-6-12(7-9-13)15-10-11-21-16(23-15)22-14-4-2-1-3-5-14/h1-11H,(H,21,22,23) |
| InChIKey | WAROUXUDRJHYAU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |