C23H18N4O — CID 10090314
4-(2-anilinopyrimidin-4-yl)-N-phenylbenzamide (PubChem CID 10090314) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is 4-(2-anilinopyrimidin-4-yl)-N-phenylbenzamide.
| Compound Name | 4-(2-anilinopyrimidin-4-yl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 10090314 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-(2-anilinopyrimidin-4-yl)-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2ccnc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H18N4O/c28-22(25-19-7-3-1-4-8-19)18-13-11-17(12-14-18)21-15-16-24-23(27-21)26-20-9-5-2-6-10-20/h1-16H,(H,25,28)(H,24,26,27) |
| InChIKey | QEDBCZHOMJLJAR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |