C31H33N7O3 — CID 142946245
acetaldehyde;1-[4-[2-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]-3-phenylurea (PubChem CID 142946245) has the molecular formula C31H33N7O3 and a molecular weight of 551.65 g/mol. Its IUPAC name is acetaldehyde;1-[4-[2-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]-3-phenylurea.
| Compound Name | acetaldehyde;1-[4-[2-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 142946245 |
| Molecular Formula | C31H33N7O3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | acetaldehyde;1-[4-[2-[4-(4-methylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]-3-phenylurea |
| SMILES | CC=O.CN1CCN(C(=O)c2ccc(Nc3nccc(-c4ccc(NC(=O)Nc5ccccc5)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C29H29N7O2.C2H4O/c1-35-17-19-36(20-18-35)27(37)22-9-13-24(14-10-22)31-28-30-16-15-26(34-28)21-7-11-25(12-8-21)33-29(38)32-23-5-3-2-4-6-23;1-2-3/h2-16H,17-20H2,1H3,(H,30,31,34)(H2,32,33,38);2H,1H3 |
| InChIKey | XYKANFXHYRYLTP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|