C29H28N6O2 — CID 24878247
N-[4-[2-[3-(4-phenylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]acetamide (PubChem CID 24878247) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[4-[2-[3-(4-phenylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]acetamide.
| Compound Name | N-[4-[2-[3-(4-phenylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 24878247 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-[4-[2-[3-(4-phenylpiperazine-1-carbonyl)anilino]pyrimidin-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccnc(Nc3cccc(C(=O)N4CCN(c5ccccc5)CC4)c3)n2)cc1 |
| InChI | InChI=1S/C29H28N6O2/c1-21(36)31-24-12-10-22(11-13-24)27-14-15-30-29(33-27)32-25-7-5-6-23(20-25)28(37)35-18-16-34(17-19-35)26-8-3-2-4-9-26/h2-15,20H,16-19H2,1H3,(H,31,36)(H,30,32,33) |
| InChIKey | RLRLYAJXQRQJTJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |