C16H11F3N4 — CID 14347000
4-pyridin-4-yl-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 14347000) has the molecular formula C16H11F3N4 and a molecular weight of 316.29 g/mol. Its IUPAC name is 4-pyridin-4-yl-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-pyridin-4-yl-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 14347000 |
| Molecular Formula | C16H11F3N4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-pyridin-4-yl-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)(F)c1cccc(Nc2nccc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C16H11F3N4/c17-16(18,19)12-2-1-3-13(10-12)22-15-21-9-6-14(23-15)11-4-7-20-8-5-11/h1-10H,(H,21,22,23) |
| InChIKey | ZBOLLVAZLJOHPX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |