C20H15F3N4 — CID 175832958
4-(1-methylindol-3-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 175832958) has the molecular formula C20H15F3N4 and a molecular weight of 368.36 g/mol. Its IUPAC name is 4-(1-methylindol-3-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(1-methylindol-3-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175832958 |
| Molecular Formula | C20H15F3N4 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-(1-methylindol-3-yl)-N-[3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | Cn1cc(-c2ccnc(Nc3cccc(C(F)(F)F)c3)n2)c2ccccc21 |
| InChI | InChI=1S/C20H15F3N4/c1-27-12-16(15-7-2-3-8-18(15)27)17-9-10-24-19(26-17)25-14-6-4-5-13(11-14)20(21,22)23/h2-12H,1H3,(H,24,25,26) |
| InChIKey | NWXMRKLRJDWSGQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |