C23H21F4N5O — CID 19966948
4-[1-(3-aminopropyl)indol-3-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 19966948) has the molecular formula C23H21F4N5O and a molecular weight of 459.45 g/mol. Its IUPAC name is 4-[1-(3-aminopropyl)indol-3-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[1-(3-aminopropyl)indol-3-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19966948 |
| Molecular Formula | C23H21F4N5O |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[1-(3-aminopropyl)indol-3-yl]-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | NCCCn1cc(-c2ccnc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)c2ccccc21 |
| InChI | InChI=1S/C23H21F4N5O/c24-21(25)23(26,27)33-16-6-3-5-15(13-16)30-22-29-11-9-19(31-22)18-14-32(12-4-10-28)20-8-2-1-7-17(18)20/h1-3,5-9,11,13-14,21H,4,10,12,28H2,(H,29,30,31) |
| InChIKey | UHJXDWNGEWAFOO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|