C22H15F4N3O — CID 19966969
4-naphthalen-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine (PubChem CID 19966969) has the molecular formula C22H15F4N3O and a molecular weight of 413.37 g/mol. Its IUPAC name is 4-naphthalen-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine.
| Compound Name | 4-naphthalen-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 19966969 |
| Molecular Formula | C22H15F4N3O |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-naphthalen-1-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrimidin-2-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccc(-c3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C22H15F4N3O/c23-20(24)22(25,26)30-16-8-4-7-15(13-16)28-21-27-12-11-19(29-21)18-10-3-6-14-5-1-2-9-17(14)18/h1-13,20H,(H,27,28,29) |
| InChIKey | RVUFCRBJUYNTSZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|