C29H29F3N4OSi — CID 162537517
N-[3-(trifluoromethyl)phenyl]-4-[9-(2-trimethylsilylethoxymethyl)carbazol-1-yl]pyrimidin-2-amine (PubChem CID 162537517) has the molecular formula C29H29F3N4OSi and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-4-[9-(2-trimethylsilylethoxymethyl)carbazol-1-yl]pyrimidin-2-amine.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-4-[9-(2-trimethylsilylethoxymethyl)carbazol-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 162537517 |
| Molecular Formula | C29H29F3N4OSi |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-4-[9-(2-trimethylsilylethoxymethyl)carbazol-1-yl]pyrimidin-2-amine |
| SMILES | C[Si](C)(C)CCOCn1c2ccccc2c2cccc(-c3ccnc(Nc4cccc(C(F)(F)F)c4)n3)c21 |
| InChI | InChI=1S/C29H29F3N4OSi/c1-38(2,3)17-16-37-19-36-26-13-5-4-10-22(26)23-11-7-12-24(27(23)36)25-14-15-33-28(35-25)34-21-9-6-8-20(18-21)29(30,31)32/h4-15,18H,16-17,19H2,1-3H3,(H,33,34,35) |
| InChIKey | SQINEGDIBCSRSB-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|