C14H10F3N5S — CID 170970744
5-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 170970744) has the molecular formula C14H10F3N5S and a molecular weight of 337.33 g/mol. Its IUPAC name is 5-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 170970744 |
| Molecular Formula | C14H10F3N5S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 5-[2-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2ccnc(Nc3cccc(C(F)(F)F)c3)n2)s1 |
| InChI | InChI=1S/C14H10F3N5S/c15-14(16,17)8-2-1-3-9(6-8)21-13-19-5-4-10(22-13)11-7-20-12(18)23-11/h1-7H,(H2,18,20)(H,19,21,22) |
| InChIKey | DUSMANQJQLNMSC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |