C13H10N6O2S — CID 87368526
5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 87368526) has the molecular formula C13H10N6O2S and a molecular weight of 314.33 g/mol. Its IUPAC name is 5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87368526 |
| Molecular Formula | C13H10N6O2S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(-c2ccnc(Nc3cccc([N+](=O)[O-])c3)n2)s1 |
| InChI | InChI=1S/C13H10N6O2S/c14-12-16-7-11(22-12)10-4-5-15-13(18-10)17-8-2-1-3-9(6-8)19(20)21/h1-7H,(H2,14,16)(H,15,17,18) |
| InChIKey | GYNGRTACEJPDOW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|