C19H14N6O2S — CID 58932505
1-N-(3-nitrophenyl)-3-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 58932505) has the molecular formula C19H14N6O2S and a molecular weight of 390.43 g/mol. Its IUPAC name is 1-N-(3-nitrophenyl)-3-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 1-N-(3-nitrophenyl)-3-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 58932505 |
| Molecular Formula | C19H14N6O2S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-N-(3-nitrophenyl)-3-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | O=[N+]([O-])c1cccc(Nc2cccc(Nc3nccc(-c4nccs4)n3)c2)c1 |
| InChI | InChI=1S/C19H14N6O2S/c26-25(27)16-6-2-5-15(12-16)22-13-3-1-4-14(11-13)23-19-21-8-7-17(24-19)18-20-9-10-28-18/h1-12,22H,(H,21,23,24) |
| InChIKey | ZHPYUTHZHUYLPM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|