C17H14N6O2 — CID 6539306
3,5-dimethyl-4-[2-(3-nitroanilino)pyrimidin-4-yl]-1H-pyrrole-2-carbonitrile (PubChem CID 6539306) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-(3-nitroanilino)pyrimidin-4-yl]-1H-pyrrole-2-carbonitrile.
| Compound Name | 3,5-dimethyl-4-[2-(3-nitroanilino)pyrimidin-4-yl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 6539306 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3,5-dimethyl-4-[2-(3-nitroanilino)pyrimidin-4-yl]-1H-pyrrole-2-carbonitrile |
| SMILES | Cc1[nH]c(C#N)c(C)c1-c1ccnc(Nc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H14N6O2/c1-10-15(9-18)20-11(2)16(10)14-6-7-19-17(22-14)21-12-4-3-5-13(8-12)23(24)25/h3-8,20H,1-2H3,(H,19,21,22) |
| InChIKey | QMDPRICJPXKZCF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|