C28H28N6O2 — CID 11598168
4-[3-[[2-(anilinomethyl)pyrrolidin-1-yl]methyl]phenyl]-N-(3-nitrophenyl)pyrimidin-2-amine (PubChem CID 11598168) has the molecular formula C28H28N6O2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[3-[[2-(anilinomethyl)pyrrolidin-1-yl]methyl]phenyl]-N-(3-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 4-[3-[[2-(anilinomethyl)pyrrolidin-1-yl]methyl]phenyl]-N-(3-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 11598168 |
| Molecular Formula | C28H28N6O2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 4-[3-[[2-(anilinomethyl)pyrrolidin-1-yl]methyl]phenyl]-N-(3-nitrophenyl)pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cccc(Nc2nccc(-c3cccc(CN4CCCC4CNc4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C28H28N6O2/c35-34(36)25-12-5-11-24(18-25)31-28-29-15-14-27(32-28)22-8-4-7-21(17-22)20-33-16-6-13-26(33)19-30-23-9-2-1-3-10-23/h1-5,7-12,14-15,17-18,26,30H,6,13,16,19-20H2,(H,29,31,32) |
| InChIKey | RJJBTAYRZULEFY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|