C27H33N5O2 — CID 11554376
[1-[[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]methyl]piperidin-2-yl]methanol (PubChem CID 11554376) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is [1-[[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]methyl]piperidin-2-yl]methanol.
| Compound Name | [1-[[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]methyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 11554376 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | [1-[[3-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]methyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1Cc1cccc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C27H33N5O2/c33-20-25-6-1-2-13-32(25)19-21-4-3-5-22(18-21)26-11-12-28-27(30-26)29-23-7-9-24(10-8-23)31-14-16-34-17-15-31/h3-5,7-12,18,25,33H,1-2,6,13-17,19-20H2,(H,28,29,30) |
| InChIKey | PTFGRXGCRRXITC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|