C13H11N5O2S2 — CID 2867135
4-methyl-5-[2-(3-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine (PubChem CID 2867135) has the molecular formula C13H11N5O2S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is 4-methyl-5-[2-(3-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[2-(3-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2867135 |
| Molecular Formula | C13H11N5O2S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-methyl-5-[2-(3-nitroanilino)-1,3-thiazol-4-yl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1-c1csc(Nc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C13H11N5O2S2/c1-7-11(22-12(14)15-7)10-6-21-13(17-10)16-8-3-2-4-9(5-8)18(19)20/h2-6H,1H3,(H2,14,15)(H,16,17) |
| InChIKey | NBNNWRUKIZZCNX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|