C13H12N4OS2 — CID 2866860
4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 2866860) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 2866860 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-[[4-(2-amino-4-methyl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Cc1nc(N)sc1-c1csc(Nc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C13H12N4OS2/c1-7-11(20-12(14)15-7)10-6-19-13(17-10)16-8-2-4-9(18)5-3-8/h2-6,18H,1H3,(H2,14,15)(H,16,17) |
| InChIKey | JXRGXGZWJHFCOH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|