C7H9ClN4S2 — CID 126477214
5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 126477214) has the molecular formula C7H9ClN4S2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 126477214 |
| Molecular Formula | C7H9ClN4S2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1nc(N)sc1-c1csc(N)n1.Cl |
| InChI | InChI=1S/C7H8N4S2.ClH/c1-3-5(13-7(9)10-3)4-2-12-6(8)11-4;/h2H,1H3,(H2,8,11)(H2,9,10);1H |
| InChIKey | HQZZKXVYCKULQM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|