About 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride
5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 126477214) has the molecular formula C7H9ClN4S2
and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 126477214 |
| Molecular Formula | C7H9ClN4S2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1nc(N)sc1-c1csc(N)n1.Cl |
| InChI | InChI=1S/C7H8N4S2.ClH/c1-3-5(13-7(9)10-3)4-2-12-6(8)11-4;/h2H,1H3,(H2,8,11)(H2,9,10);1H |
| InChIKey | HQZZKXVYCKULQM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazole_amine_A(4)', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride (CID 126477214) is 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride is Cc1nc(N)sc1-c1csc(N)n1.Cl.
What is the InChIKey of 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is HQZZKXVYCKULQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S2.ClH/c1-3-5(13-7(9)10-3)4-2-12-6(8)11-4;/h2H,1H3,(H2,8,11)(H2,9,10);1H.
What are the key properties of 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride?
5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 248.76 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-amino-1,3-thiazol-4-yl)-4-methyl-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 126477214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).