C4H8Cl2N2S — CID 87626101
4-methyl-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 87626101) has the molecular formula C4H8Cl2N2S and a molecular weight of 187.09 g/mol. Its IUPAC name is 4-methyl-1,3-thiazol-2-amine;dihydrochloride.
| Compound Name | 4-methyl-1,3-thiazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 87626101 |
| Molecular Formula | C4H8Cl2N2S |
| Molecular Weight | 187.09 g/mol |
| Exact Mass | 185.98 |
| IUPAC Name | 4-methyl-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | Cc1csc(N)n1.Cl.Cl |
| InChI | InChI=1S/C4H6N2S.2ClH/c1-3-2-7-4(5)6-3;;/h2H,1H3,(H2,5,6);2*1H |
| InChIKey | KXKPHELJHIUNTI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |