C11H13ClN2S — CID 2870539
4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride (PubChem CID 2870539) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 2870539 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1ccc(-c2csc(N)n2)cc1C.Cl |
| InChI | InChI=1S/C11H12N2S.ClH/c1-7-3-4-9(5-8(7)2)10-6-14-11(12)13-10;/h3-6H,1-2H3,(H2,12,13);1H |
| InChIKey | XCIBGTGCDHTHPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |