C17H14N2O2S — CID 155410143
4-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-methylbenzoic acid (PubChem CID 155410143) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-methylbenzoic acid.
| Compound Name | 4-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 155410143 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[3-(2-amino-1,3-thiazol-4-yl)phenyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(-c2cccc(-c3csc(N)n3)c2)ccc1C(=O)O |
| InChI | InChI=1S/C17H14N2O2S/c1-10-7-12(5-6-14(10)16(20)21)11-3-2-4-13(8-11)15-9-22-17(18)19-15/h2-9H,1H3,(H2,18,19)(H,20,21) |
| InChIKey | APLXVWPPRIARBK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |