C22H14ClNO2S — CID 118577090
2-chloro-4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzoic acid (PubChem CID 118577090) has the molecular formula C22H14ClNO2S and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-chloro-4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 118577090 |
| Molecular Formula | C22H14ClNO2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-chloro-4-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(-c3csc(-c4ccccc4)n3)c2)cc1Cl |
| InChI | InChI=1S/C22H14ClNO2S/c23-19-12-16(9-10-18(19)22(25)26)15-7-4-8-17(11-15)20-13-27-21(24-20)14-5-2-1-3-6-14/h1-13H,(H,25,26) |
| InChIKey | XNIFLDAOCASBJA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |