3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid

C17H11F2NO2S — CID 118075231

IUPAC3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2nc(-c3ccc(C(F)F)cc3)cs2)c1
InChIInChI=1S/C17H11F2NO2S/c18-15(19)11-6-4-10(5-7-11)14-9-23-16(20-14)12-2-1-3-13(8-12)17(21)22/h1-9,15H,(H,21,22)
InChIKeyQNIOIHKWRZLHDD-UHFFFAOYSA-N
MW331.34 g/mol
LogP5.11
Rot. Bonds4

About 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid

3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 118075231) has the molecular formula C17H11F2NO2S and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid.

Molecular Properties

Compound Name3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid
PubChem CID118075231
Molecular FormulaC17H11F2NO2S
Molecular Weight331.34 g/mol
Exact Mass331.05
IUPAC Name3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2nc(-c3ccc(C(F)F)cc3)cs2)c1
InChIInChI=1S/C17H11F2NO2S/c18-15(19)11-6-4-10(5-7-11)14-9-23-16(20-14)12-2-1-3-13(8-12)17(21)22/h1-9,15H,(H,21,22)
InChIKeyQNIOIHKWRZLHDD-UHFFFAOYSA-N
XLogP5.11
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500331.34
LogP ≤ 55.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid?
The IUPAC name of 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid (CID 118075231) is 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid.
What is the SMILES notation for 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid?
The canonical SMILES for 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid is O=C(O)c1cccc(-c2nc(-c3ccc(C(F)F)cc3)cs2)c1.
What is the InChIKey of 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid?
The InChIKey is QNIOIHKWRZLHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F2NO2S/c18-15(19)11-6-4-10(5-7-11)14-9-23-16(20-14)12-2-1-3-13(8-12)17(21)22/h1-9,15H,(H,21,22).
What are the key properties of 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid?
3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid has a molecular weight of 331.34 g/mol, XLogP of 5.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid is sourced from PubChem (CID 118075231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).