C17H11F2NO2S — CID 118075231
3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 118075231) has the molecular formula C17H11F2NO2S and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 118075231 |
| Molecular Formula | C17H11F2NO2S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-[4-[4-(difluoromethyl)phenyl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nc(-c3ccc(C(F)F)cc3)cs2)c1 |
| InChI | InChI=1S/C17H11F2NO2S/c18-15(19)11-6-4-10(5-7-11)14-9-23-16(20-14)12-2-1-3-13(8-12)17(21)22/h1-9,15H,(H,21,22) |
| InChIKey | QNIOIHKWRZLHDD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |