C19H18N2O4S2 — CID 60529021
3-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 60529021) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 3-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 60529021 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | CS(=O)(=O)NCCc1ccc(-c2csc(-c3cccc(C(=O)O)c3)n2)cc1 |
| InChI | InChI=1S/C19H18N2O4S2/c1-27(24,25)20-10-9-13-5-7-14(8-6-13)17-12-26-18(21-17)15-3-2-4-16(11-15)19(22)23/h2-8,11-12,20H,9-10H2,1H3,(H,22,23) |
| InChIKey | WNAJRACJYHMGNE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |