3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid

C14H8BrNO2S2 — CID 63540780

IUPAC3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2nc(-c3ccc(Br)s3)cs2)c1
InChIInChI=1S/C14H8BrNO2S2/c15-12-5-4-11(20-12)10-7-19-13(16-10)8-2-1-3-9(6-8)14(17)18/h1-7H,(H,17,18)
InChIKeyMFWYSHFRYHOSFK-UHFFFAOYSA-N
MW366.26 g/mol
LogP5.00
Rot. Bonds3

About 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid

3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid (PubChem CID 63540780) has the molecular formula C14H8BrNO2S2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid.

Molecular Properties

Compound Name3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid
PubChem CID63540780
Molecular FormulaC14H8BrNO2S2
Molecular Weight366.26 g/mol
Exact Mass364.92
IUPAC Name3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid
SMILESO=C(O)c1cccc(-c2nc(-c3ccc(Br)s3)cs2)c1
InChIInChI=1S/C14H8BrNO2S2/c15-12-5-4-11(20-12)10-7-19-13(16-10)8-2-1-3-9(6-8)14(17)18/h1-7H,(H,17,18)
InChIKeyMFWYSHFRYHOSFK-UHFFFAOYSA-N
XLogP5.00
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.26
LogP ≤ 55.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid?
The IUPAC name of 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid (CID 63540780) is 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid.
What is the SMILES notation for 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid?
The canonical SMILES for 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid is O=C(O)c1cccc(-c2nc(-c3ccc(Br)s3)cs2)c1.
What is the InChIKey of 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid?
The InChIKey is MFWYSHFRYHOSFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrNO2S2/c15-12-5-4-11(20-12)10-7-19-13(16-10)8-2-1-3-9(6-8)14(17)18/h1-7H,(H,17,18).
What are the key properties of 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid?
3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid has a molecular weight of 366.26 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]benzoic acid is sourced from PubChem (CID 63540780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).