C11H7NO4S — CID 18548742
4-(3-carboxyphenyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 18548742) has the molecular formula C11H7NO4S and a molecular weight of 249.25 g/mol. Its IUPAC name is 4-(3-carboxyphenyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(3-carboxyphenyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 18548742 |
| Molecular Formula | C11H7NO4S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 4-(3-carboxyphenyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(-c2csc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C11H7NO4S/c13-10(14)7-3-1-2-6(4-7)8-5-17-9(12-8)11(15)16/h1-5H,(H,13,14)(H,15,16) |
| InChIKey | WTQSLQOYCIQTHT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |