C10H5ClFNO2S — CID 79566531
4-(3-chloro-4-fluorophenyl)-1,3-thiazole-2-carboxylic acid (PubChem CID 79566531) has the molecular formula C10H5ClFNO2S and a molecular weight of 257.67 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 79566531 |
| Molecular Formula | C10H5ClFNO2S |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc(F)c(Cl)c2)cs1 |
| InChI | InChI=1S/C10H5ClFNO2S/c11-6-3-5(1-2-7(6)12)8-4-16-9(13-8)10(14)15/h1-4H,(H,14,15) |
| InChIKey | KIFSFCQEQHQOCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |