C11H6ClF2NOS — CID 83969157
2-chloro-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 83969157) has the molecular formula C11H6ClF2NOS and a molecular weight of 273.69 g/mol. Its IUPAC name is 2-chloro-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 83969157 |
| Molecular Formula | C11H6ClF2NOS |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 2-chloro-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | O=C(CCl)c1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C11H6ClF2NOS/c12-4-10(16)11-15-9(5-17-11)6-1-2-7(13)8(14)3-6/h1-3,5H,4H2 |
| InChIKey | BHEFRMNCZOHJOC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|