C13H10ClNO3S — CID 83969143
2-chloro-1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]ethanone (PubChem CID 83969143) has the molecular formula C13H10ClNO3S and a molecular weight of 295.75 g/mol. Its IUPAC name is 2-chloro-1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 83969143 |
| Molecular Formula | C13H10ClNO3S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 2-chloro-1-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]ethanone |
| SMILES | O=C(CCl)c1nc(-c2ccc3c(c2)OCCO3)cs1 |
| InChI | InChI=1S/C13H10ClNO3S/c14-6-10(16)13-15-9(7-19-13)8-1-2-11-12(5-8)18-4-3-17-11/h1-2,5,7H,3-4,6H2 |
| InChIKey | SSFLVPKXJJSKTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|