C13H12ClNO2S — CID 83969147
2-chloro-1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 83969147) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is 2-chloro-1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 83969147 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-chloro-1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | CCOc1ccc(-c2csc(C(=O)CCl)n2)cc1 |
| InChI | InChI=1S/C13H12ClNO2S/c1-2-17-10-5-3-9(4-6-10)11-8-18-13(15-11)12(16)7-14/h3-6,8H,2,7H2,1H3 |
| InChIKey | KPSXAGQWEPUPQN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|