C13H16N2OS — CID 1497789
2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 1497789) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 1497789 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | CCOc1ccc(-c2csc(CCN)n2)cc1 |
| InChI | InChI=1S/C13H16N2OS/c1-2-16-11-5-3-10(4-6-11)12-9-17-13(15-12)7-8-14/h3-6,9H,2,7-8,14H2,1H3 |
| InChIKey | YIFKIDKVWXTGNY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |