C15H13N2O4S- — CID 4746122
4-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoate (PubChem CID 4746122) has the molecular formula C15H13N2O4S- and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoate.
| Compound Name | 4-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4746122 |
| Molecular Formula | C15H13N2O4S- |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-[[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoate |
| SMILES | CCOc1ccc(-c2csc(NC(=O)C=CC(=O)[O-])n2)cc1 |
| InChI | InChI=1S/C15H14N2O4S/c1-2-21-11-5-3-10(4-6-11)12-9-22-15(16-12)17-13(18)7-8-14(19)20/h3-9H,2H2,1H3,(H,19,20)(H,16,17,18)/p-1 |
| InChIKey | GJPLXODSICPNEY-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|