About 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol
2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol (PubChem CID 116966829) has the molecular formula C11H10F2N2OS
and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol |
| PubChem CID | 116966829 |
| Molecular Formula | C11H10F2N2OS |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol |
| SMILES | NCC(O)c1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C11H10F2N2OS/c12-7-2-1-6(3-8(7)13)9-5-17-11(15-9)10(16)4-14/h1-3,5,10,16H,4,14H2 |
| InChIKey | RWBZCRJMIRSYQK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol?
The IUPAC name of 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol (CID 116966829) is 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol.
What is the SMILES notation for 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol?
The canonical SMILES for 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol is NCC(O)c1nc(-c2ccc(F)c(F)c2)cs1.
What is the InChIKey of 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol?
The InChIKey is RWBZCRJMIRSYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2OS/c12-7-2-1-6(3-8(7)13)9-5-17-11(15-9)10(16)4-14/h1-3,5,10,16H,4,14H2.
What are the key properties of 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol?
2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol has a molecular weight of 256.28 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethanol is sourced from PubChem (CID 116966829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).