C18H14F2N2OS — CID 127048131
N-[2-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethyl]benzamide (PubChem CID 127048131) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is N-[2-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethyl]benzamide.
| Compound Name | N-[2-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 127048131 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-[2-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nc(-c2ccc(F)c(F)c2)cs1)c1ccccc1 |
| InChI | InChI=1S/C18H14F2N2OS/c19-14-7-6-13(10-15(14)20)16-11-24-17(22-16)8-9-21-18(23)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H,21,23) |
| InChIKey | PGAVLLIWQZIHIC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |