C19H19ClN2OS — CID 52984164
N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide;hydrochloride (PubChem CID 52984164) has the molecular formula C19H19ClN2OS and a molecular weight of 358.89 g/mol. Its IUPAC name is N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide;hydrochloride.
| Compound Name | N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 52984164 |
| Molecular Formula | C19H19ClN2OS |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide;hydrochloride |
| SMILES | Cc1nc(-c2ccc(CCNC(=O)c3ccccc3)cc2)cs1.Cl |
| InChI | InChI=1S/C19H18N2OS.ClH/c1-14-21-18(13-23-14)16-9-7-15(8-10-16)11-12-20-19(22)17-5-3-2-4-6-17;/h2-10,13H,11-12H2,1H3,(H,20,22);1H |
| InChIKey | VDGFCCLCTHRNRL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |