C21H22N2OS — CID 16568166
4-ethyl-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide (PubChem CID 16568166) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is 4-ethyl-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-ethyl-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 16568166 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-ethyl-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
| SMILES | CCc1ccc(C(=O)NCCc2ccc(-c3csc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C21H22N2OS/c1-3-16-4-10-19(11-5-16)21(24)22-13-12-17-6-8-18(9-7-17)20-14-25-15(2)23-20/h4-11,14H,3,12-13H2,1-2H3,(H,22,24) |
| InChIKey | FIJLJKLKZQLSQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |