C20H17N3OS — CID 16568157
4-cyano-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide (PubChem CID 16568157) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-cyano-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-cyano-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 16568157 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-cyano-N-[2-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]ethyl]benzamide |
| SMILES | Cc1nc(-c2ccc(CCNC(=O)c3ccc(C#N)cc3)cc2)cs1 |
| InChI | InChI=1S/C20H17N3OS/c1-14-23-19(13-25-14)17-6-2-15(3-7-17)10-11-22-20(24)18-8-4-16(12-21)5-9-18/h2-9,13H,10-11H2,1H3,(H,22,24) |
| InChIKey | ROCOHLFANCEFRX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |