C19H15N3O2S — CID 110393548
3-cyano-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide (PubChem CID 110393548) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 3-cyano-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 110393548 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-cyano-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NCCc2nc(-c3ccc(O)cc3)cs2)c1 |
| InChI | InChI=1S/C19H15N3O2S/c20-11-13-2-1-3-15(10-13)19(24)21-9-8-18-22-17(12-25-18)14-4-6-16(23)7-5-14/h1-7,10,12,23H,8-9H2,(H,21,24) |
| InChIKey | BMDPOUZXQRYADX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |